CAS 1354954-02-1 appears in our catalog under these names: 7-Chloro-2-phenyl-(1,2,4)triazolo(1,5-c)pyrimidine, 98%, 7-Chloro-2-phenyl-(1,2,4)triazolo(1,5-c)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-chloro-2-phenyl-[1,2,4]triazolo[1,5-c]pyrimidine (CAS 1354954-02-1) is a chemical compound with the molecular formula C11H7ClN4 and a molecular weight of 230.65 g/mol. IUPAC name: 7-chloro-2-phenyl-[1,2,4]triazolo[1,5-c]pyrimidine. InChIKey: MSTGTUSZWCONIJ-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN4 |
|---|---|
| Molecular weight | 230.65 g/mol |
| IUPAC name | 7-chloro-2-phenyl-[1,2,4]triazolo[1,5-c]pyrimidine |
| InChIKey | MSTGTUSZWCONIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN3C=NC(=CC3=N2)Cl |
Computed by PubChem (NCBI)