cas: 853577-50-1 — see every product listed under this CAS number, including other names
4-Chloro-1H-pyrrolo[3,4-c]pyridin-3(2H)-one (CAS 853577-50-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093511-100MG |
| cas | 853577-50-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 3324.89 Pln | |
| Fluorochem | 1g | 13946.15 Pln |
| delivery time | 3-4 weeks |
|---|
4-chloro-1,2-dihydropyrrolo[3,4-c]pyridin-3-one (CAS 853577-50-1) is a chemical compound with the molecular formula C7H5ClN2O and a molecular weight of 168.58 g/mol. IUPAC name: 4-chloro-1,2-dihydropyrrolo[3,4-c]pyridin-3-one. InChIKey: QKFIPKNZESNEQL-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O |
|---|---|
| Molecular weight | 168.58 g/mol |
| IUPAC name | 4-chloro-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
| InChIKey | QKFIPKNZESNEQL-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=O)N1)C(=NC=C2)Cl |
Computed by PubChem (NCBI)