Products 853577-50-1
CAS 853577-50-1 appears in our catalog under these names: 4-Chloro-1h-pyrrolo[3,4-c]pyridin-3(2H)-one, 97%, 4-Chloro-1H-pyrrolo(3,4-c)pyridin-3(2H)-one, 97%, 4-Chloro-1H-pyrrolo[3,4-c]pyridin-3(2H)-one. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
4-chloro-1,2-dihydropyrrolo[3,4-c]pyridin-3-one (CAS 853577-50-1) is a chemical compound with the molecular formula C7H5ClN2O and a molecular weight of 168.58 g/mol. IUPAC name: 4-chloro-1,2-dihydropyrrolo[3,4-c]pyridin-3-one. InChIKey: QKFIPKNZESNEQL-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O |
|---|---|
| Molecular weight | 168.58 g/mol |
| IUPAC name | 4-chloro-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
| InChIKey | QKFIPKNZESNEQL-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=O)N1)C(=NC=C2)Cl |
Computed by PubChem (NCBI)