cas: 59886-90-7 — see every product listed under this CAS number, including other names
4-Chloro-2,3-dimethylpyridine 1-oxide 98% (CAS 59886-90-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A810543-5g |
| cas | 59886-90-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 142.31 Pln | |
| Ambeed | 25g | 359.25 Pln | |
| Ambeed | 100g | 776.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A810543 |
4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium (CAS 59886-90-7) is a chemical compound with the molecular formula C7H8ClNO and a molecular weight of 157.60 g/mol. IUPAC name: 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium. InChIKey: MCUYHRNUDDANSO-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO |
|---|---|
| Molecular weight | 157.60 g/mol |
| IUPAC name | 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium |
| InChIKey | MCUYHRNUDDANSO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1C)[O-])Cl |
Computed by PubChem (NCBI)