cas: 59886-90-7 — see every product listed under this CAS number, including other names
4-Chloro-2,3-dimethylpyridine 1-oxide (CAS 59886-90-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F068348-1G |
| cas | 59886-90-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 10g | 247.85 Pln | |
| Fluorochem | 25g | 456.11 Pln | |
| Fluorochem | 100g | 1388.07 Pln |
| delivery time | 3-4 weeks |
|---|
4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium (CAS 59886-90-7) is a chemical compound with the molecular formula C7H8ClNO and a molecular weight of 157.60 g/mol. IUPAC name: 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium. InChIKey: MCUYHRNUDDANSO-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO |
|---|---|
| Molecular weight | 157.60 g/mol |
| IUPAC name | 4-chloro-2,3-dimethyl-1-oxidopyridin-1-ium |
| InChIKey | MCUYHRNUDDANSO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1C)[O-])Cl |
Computed by PubChem (NCBI)