cas: 134221-52-6 — see every product listed under this CAS number, including other names
4-Chloro-2,6-dimethoxypyrimidine-5-carbaldehyde 97% (CAS 134221-52-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A199693-100mg |
| cas | 134221-52-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1037.88 Pln | |
| Ambeed | 5g | 4520.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A199693 |
4-chloro-2,6-dimethoxypyrimidine-5-carbaldehyde (CAS 134221-52-6) is a chemical compound with the molecular formula C7H7ClN2O3 and a molecular weight of 202.59 g/mol. IUPAC name: 4-chloro-2,6-dimethoxypyrimidine-5-carbaldehyde. InChIKey: KSUIGOHQLMJUSE-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O3 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | 4-chloro-2,6-dimethoxypyrimidine-5-carbaldehyde |
| InChIKey | KSUIGOHQLMJUSE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC(=N1)OC)Cl)C=O |
Computed by PubChem (NCBI)