cas: 134221-52-6 — see every product listed under this CAS number, including other names
4-Chloro-2,6-dimethoxypyrimidine-5-carbaldehyde, 97%, 97% (CAS 134221-52-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110GDF-100mg |
| cas | 134221-52-6 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 1g | 2411.60 Pln | |
| Chemat | 5g | 7034.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-chloro-2,6-dimethoxypyrimidine-5-carbaldehyde (CAS 134221-52-6) is a chemical compound with the molecular formula C7H7ClN2O3 and a molecular weight of 202.59 g/mol. IUPAC name: 4-chloro-2,6-dimethoxypyrimidine-5-carbaldehyde. InChIKey: KSUIGOHQLMJUSE-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O3 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | 4-chloro-2,6-dimethoxypyrimidine-5-carbaldehyde |
| InChIKey | KSUIGOHQLMJUSE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC(=N1)OC)Cl)C=O |
Computed by PubChem (NCBI)