4-Chloro-2,6-dimethylbenzoic acid, 98%
cas: 35887-72-0 — see every product listed under this CAS number, including other names
4-Chloro-2,6-dimethylbenzoic acid, 98% (CAS 35887-72-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg, 2.5g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11CRKQ-100mg |
| cas | 35887-72-0 |
| size | 100mg |
| availability | 73g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 683.60 Pln | |
| Chemat | 250mg | 1125.20 Pln | |
| Chemat | 1g | 2421.20 Pln | |
| Fluorochem | 100mg | 1247.50 Pln | |
| Fluorochem | 250mg | 1580.71 Pln | |
| Fluorochem | 500mg | 2179.46 Pln | |
| Fluorochem | 1g | 2679.28 Pln | |
| Fluorochem | 2.5g | 4767.09 Pln | |
| Fluorochem | 5g | 8114.87 Pln | |
| Fluorochem | 10g | 13493.18 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-chloro-2,6-dimethylbenzoic acid (CAS 35887-72-0) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. IUPAC name: 4-chloro-2,6-dimethylbenzoic acid. InChIKey: ONVNRYJOMHDJER-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 4-chloro-2,6-dimethylbenzoic acid |
| InChIKey | ONVNRYJOMHDJER-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)C)Cl |
Computed by PubChem (NCBI)