cas: 2915-15-3 — see every product listed under this CAS number, including other names
4-Chloro-2-methyl-6-phenylpyrimidine, 97%, 97% (CAS 2915-15-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11VWH8-250mg |
| cas | 2915-15-3 |
| size | 250mg |
| availability | 54.65g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 510.80 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1715.60 Pln | |
| Chemat | 50g | 2819.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-chloro-2-methyl-6-phenylpyrimidine (CAS 2915-15-3) is a chemical compound with the molecular formula C11H9ClN2 and a molecular weight of 204.65 g/mol. IUPAC name: 4-chloro-2-methyl-6-phenylpyrimidine. InChIKey: MKRVYJDOHARDKT-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2 |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 4-chloro-2-methyl-6-phenylpyrimidine |
| InChIKey | MKRVYJDOHARDKT-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)Cl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)