cas: 2915-15-3 — see every product listed under this CAS number, including other names
4-Chloro-2-methyl-6-phenylpyrimidine, 98% (CAS 2915-15-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F517665-100MG |
| cas | 2915-15-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 1950.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-2-methyl-6-phenylpyrimidine (CAS 2915-15-3) is a chemical compound with the molecular formula C11H9ClN2 and a molecular weight of 204.65 g/mol. IUPAC name: 4-chloro-2-methyl-6-phenylpyrimidine. InChIKey: MKRVYJDOHARDKT-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2 |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 4-chloro-2-methyl-6-phenylpyrimidine |
| InChIKey | MKRVYJDOHARDKT-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)Cl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)