cas: 89-64-5 — see every product listed under this CAS number, including other names
4-Chloro-2-nitrophenol, >98.0%(GC)(T) (CAS 89-64-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C0228-25G |
| cas | 89-64-5 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 123.26 Pln | |
| TCI | 500g | 1327.99 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
4-chloro-2-nitrophenol (CAS 89-64-5) is a chemical compound with the molecular formula C6H4ClNO3 and a molecular weight of 173.55 g/mol. IUPAC name: 4-chloro-2-nitrophenol. InChIKey: NWSIFTLPLKCTSX-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO3 |
|---|---|
| Molecular weight | 173.55 g/mol |
| IUPAC name | 4-chloro-2-nitrophenol |
| InChIKey | NWSIFTLPLKCTSX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)[N+](=O)[O-])O |
Computed by PubChem (NCBI)