CAS 491-11-2 appears in our catalog under these names: 3-Chloro-4-nitrophenol, >95% (HPLC), 3–Chloro–4–nitrophenol, 3-Chloro-4-nitrophenol 97%, 3-Chloro-4-nitrophenol, 97%, 97%, 3-Chloro-4-nitrophenol, 95%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 500mg, 25g, 5g, 500g, 10g, 100g.
3-chloro-4-nitrophenol (CAS 491-11-2) is a chemical compound with the molecular formula C6H4ClNO3 and a molecular weight of 173.55 g/mol. IUPAC name: 3-chloro-4-nitrophenol. InChIKey: DKTRZBWXGOPYIX-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO3 |
|---|---|
| Molecular weight | 173.55 g/mol |
| IUPAC name | 3-chloro-4-nitrophenol |
| InChIKey | DKTRZBWXGOPYIX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)