cas: 320-41-2 — see every product listed under this CAS number, including other names
4-Chloro-2-trifluoromethylbenzonitrile, 96% (CAS 320-41-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033578-1G |
| cas | 320-41-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 25g | 664.37 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-2-(trifluoromethyl)benzonitrile (CAS 320-41-2) is a chemical compound with the molecular formula C8H3ClF3N and a molecular weight of 205.56 g/mol. IUPAC name: 4-chloro-2-(trifluoromethyl)benzonitrile. InChIKey: GRNQHTXPUDZMGB-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3N |
|---|---|
| Molecular weight | 205.56 g/mol |
| IUPAC name | 4-chloro-2-(trifluoromethyl)benzonitrile |
| InChIKey | GRNQHTXPUDZMGB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)C#N |
Computed by PubChem (NCBI)