CAS 1092460-79-1 appears in our catalog under these names: 3-Chloro-4-(trifluoromethyl)benzonitrile 98%, 3-Chloro-4-(trifluoromethyl)benzonitrile 96%, 3-Chloro-4-(trifluoromethyl)benzonitrile, 96%. Offered by: Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 10g.
3-chloro-4-(trifluoromethyl)benzonitrile (CAS 1092460-79-1) is a chemical compound with the molecular formula C8H3ClF3N and a molecular weight of 205.56 g/mol. IUPAC name: 3-chloro-4-(trifluoromethyl)benzonitrile. InChIKey: IWZFPSVQIDJRAD-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3N |
|---|---|
| Molecular weight | 205.56 g/mol |
| IUPAC name | 3-chloro-4-(trifluoromethyl)benzonitrile |
| InChIKey | IWZFPSVQIDJRAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)