Products 2915326-73-5
CAS 2915326-73-5 is the registry number for 2-(Chloroethynyl)-6-(trifluoromethyl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-chloroethynyl)-6-(trifluoromethyl)pyridine (CAS 2915326-73-5) is a chemical compound with the molecular formula C8H3ClF3N and a molecular weight of 205.56 g/mol. IUPAC name: 2-(2-chloroethynyl)-6-(trifluoromethyl)pyridine. InChIKey: KQIXGMQMHASTBN-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3N |
|---|---|
| Molecular weight | 205.56 g/mol |
| IUPAC name | 2-(2-chloroethynyl)-6-(trifluoromethyl)pyridine |
| InChIKey | KQIXGMQMHASTBN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(F)(F)F)C#CCl |
Computed by PubChem (NCBI)