CAS 601465-68-3 is the registry number for 2-Chloro-5-(trifluoromethyl)phenyl isocyanide. Offered by: TRC. Available pack sizes: 2,5g.
1-chloro-2-isocyano-4-(trifluoromethyl)benzene (CAS 601465-68-3) is a chemical compound with the molecular formula C8H3ClF3N and a molecular weight of 205.56 g/mol. IUPAC name: 1-chloro-2-isocyano-4-(trifluoromethyl)benzene. InChIKey: YIIXVYUXPQFHIO-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3N |
|---|---|
| Molecular weight | 205.56 g/mol |
| IUPAC name | 1-chloro-2-isocyano-4-(trifluoromethyl)benzene |
| InChIKey | YIIXVYUXPQFHIO-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C1=C(C=CC(=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)