4-Chloro-3,3-dimethyl-2,3-dihydro-1H-inden-1-one, 95%
cas: 479070-71-8 — see every product listed under this CAS number, including other names
4-Chloro-3,3-dimethyl-2,3-dihydro-1H-inden-1-one, 95% (CAS 479070-71-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A809139-250mg |
| cas | 479070-71-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 704.12 Pln | |
| Ambeed | 1g | 1844.44 Pln | |
| BLDpharm | 100mg | 419.88 Pln | |
| BLDpharm | 250mg | 697.56 Pln | |
| BLDpharm | 1g | 1808.28 Pln | |
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1048.40 Pln | |
| Chemat | 1g | 2819.60 Pln | |
| Fluorochem | 100mg | 1122.54 Pln | |
| Fluorochem | 250mg | 1934.75 Pln | |
| Fluorochem | 1g | 5230.47 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-chloro-3,3-dimethyl-2H-inden-1-one (CAS 479070-71-8) is a chemical compound with the molecular formula C11H11ClO and a molecular weight of 194.66 g/mol. IUPAC name: 4-chloro-3,3-dimethyl-2H-inden-1-one. InChIKey: BOYYNLGELBTMFL-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 4-chloro-3,3-dimethyl-2H-inden-1-one |
| InChIKey | BOYYNLGELBTMFL-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C1C(=CC=C2)Cl)C |
Computed by PubChem (NCBI)