CAS 479070-71-8 appears in our catalog under these names: 4-Chloro-3,3-dimethyl-2,3-dihydro-1H-inden-1-one, 95%, 95%, 4-Chloro-3,3-dimethyl-2,3-dihydro-1H-inden-1-one, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-3,3-dimethyl-2H-inden-1-one (CAS 479070-71-8) is a chemical compound with the molecular formula C11H11ClO and a molecular weight of 194.66 g/mol. IUPAC name: 4-chloro-3,3-dimethyl-2H-inden-1-one. InChIKey: BOYYNLGELBTMFL-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 4-chloro-3,3-dimethyl-2H-inden-1-one |
| InChIKey | BOYYNLGELBTMFL-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=C1C(=CC=C2)Cl)C |
Computed by PubChem (NCBI)