Products 62584-23-0
CAS 62584-23-0 is the registry number for 4–Chloro–3–(trifluoromethyl)benzamide. Offered by: GLPBio. Available pack sizes: 10g, 5g.
4-chloro-3-(trifluoromethyl)benzamide (CAS 62584-23-0) is a chemical compound with the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. IUPAC name: 4-chloro-3-(trifluoromethyl)benzamide. InChIKey: PIYDLRBTABXQSP-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO |
|---|---|
| Molecular weight | 223.58 g/mol |
| IUPAC name | 4-chloro-3-(trifluoromethyl)benzamide |
| InChIKey | PIYDLRBTABXQSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)C(F)(F)F)Cl |
Computed by PubChem (NCBI)