CAS 154598-53-5 appears in our catalog under these names: 2'-Amino-5'-chloro-2,2,2-trifluoroacetophenone, 98%, 1-(2-Amino-5-chlorophenyl)-2,2,2-trifluoroethanone, 4-Chloro-2-Trifluoroacetylaniline, 1-(2-Amino-5-chlorophenyl)-2,2,2-trifluoroethanone, 97%, 1-(2-Amino-5-chlorophenyl)-2,2,2-trifluoroethanone, 97%, 97%. Offered by: Combi-blocks, Mikromol, Chemat Brand, TRC, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 25mg, on request, 100mg, 250mg.
1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone (CAS 154598-53-5) is a chemical compound with the molecular formula C8H5ClF3NO and a molecular weight of 223.58 g/mol. IUPAC name: 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone. InChIKey: NOKSRMDODJGCPZ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO |
|---|---|
| Molecular weight | 223.58 g/mol |
| IUPAC name | 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone |
| InChIKey | NOKSRMDODJGCPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)C(F)(F)F)N |
Computed by PubChem (NCBI)