cas: 62039-92-3 — see every product listed under this CAS number, including other names
4-Chloro-3-(trifluoromethyl)benzylamine (CAS 62039-92-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007809-1G |
| cas | 62039-92-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 502.97 Pln | |
| Fluorochem | 10g | 549.82 Pln | |
| Fluorochem | 25g | 1299.56 Pln | |
| Fluorochem | 100g | 4100.66 Pln |
| delivery time | 1-2 weeks |
|---|
[4-chloro-3-(trifluoromethyl)phenyl]methanamine (CAS 62039-92-3) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: [4-chloro-3-(trifluoromethyl)phenyl]methanamine. InChIKey: SRHQOQMNBVOXCF-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | [4-chloro-3-(trifluoromethyl)phenyl]methanamine |
| InChIKey | SRHQOQMNBVOXCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN)C(F)(F)F)Cl |
Computed by PubChem (NCBI)