cas: 445303-09-3 — see every product listed under this CAS number, including other names
4-Chloro-3-(trifluoromethyl)phenylboronic acid pinacol ester, 98% (CAS 445303-09-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219500-1G |
| cas | 445303-09-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 346.77 Pln | |
| Fluorochem | 25g | 1356.83 Pln | |
| Fluorochem | 100g | 4350.57 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-[4-chloro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 445303-09-3) is a chemical compound with the molecular formula C13H15BClF3O2 and a molecular weight of 306.52 g/mol. IUPAC name: 2-[4-chloro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VBNMWVUQPRYIIM-UHFFFAOYSA-N.
| Molecular formula | C13H15BClF3O2 |
|---|---|
| Molecular weight | 306.52 g/mol |
| IUPAC name | 2-[4-chloro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VBNMWVUQPRYIIM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)