4-Chloro-3-trifluoromethylphenylboronic acid, pinacol ester, 98%, 98%
cas: 445303-09-3 — see every product listed under this CAS number, including other names
4-Chloro-3-trifluoromethylphenylboronic acid, pinacol ester, 98%, 98% (CAS 445303-09-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D0RA-250mg |
| cas | 445303-09-3 |
| size | 250mg |
| availability | 125g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 318.80 Pln | |
| Chemat | 25g | 1058.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[4-chloro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 445303-09-3) is a chemical compound with the molecular formula C13H15BClF3O2 and a molecular weight of 306.52 g/mol. IUPAC name: 2-[4-chloro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VBNMWVUQPRYIIM-UHFFFAOYSA-N.
| Molecular formula | C13H15BClF3O2 |
|---|---|
| Molecular weight | 306.52 g/mol |
| IUPAC name | 2-[4-chloro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VBNMWVUQPRYIIM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
4-Chloro-3-(trifluoromethyl)phenylboronic acid pinacol ester, 2-[4-Chloro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4-Chloro-3-trifluoromethylphenylboronic acid pinacol ester, C13H15BClF3O2, 4-Chloro-3-(trifluoromethyl)benzeneboronic acid, pinacol ester, 2-(4-chloro-3-trifluoromethyl-phenyl)-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane, 4-Chloro-3-(trifluoromethyl)phenyl-boronic acid pinacol ester, 4-Chloro-3-trifluoromethylphenylboronic acid pinacol ester, AldrichCPR, 2-(4-chloro-3-trifluoromethyl-phenyl)-4,4,5,5-tetramethyl-[1,3,2] dioxaborolane