cas: 328-87-0 — see every product listed under this CAS number, including other names
4-Chloro-3-cyanobenzotrifluoride, 97% (CAS 328-87-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F003149-1G |
| cas | 328-87-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 25g | 164.54 Pln | |
| Fluorochem | 100g | 440.49 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97% |
2-chloro-5-(trifluoromethyl)benzonitrile (CAS 328-87-0) is a chemical compound with the molecular formula C8H3ClF3N and a molecular weight of 205.56 g/mol. IUPAC name: 2-chloro-5-(trifluoromethyl)benzonitrile. InChIKey: LCISFYAQKHOWBP-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF3N |
|---|---|
| Molecular weight | 205.56 g/mol |
| IUPAC name | 2-chloro-5-(trifluoromethyl)benzonitrile |
| InChIKey | LCISFYAQKHOWBP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C#N)Cl |
Computed by PubChem (NCBI)