cas: 874831-46-6 — see every product listed under this CAS number, including other names
4-Chloro-5,7-difluoroquinoline, 98% (CAS 874831-46-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F759438-100MG |
| cas | 874831-46-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 820.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-5,7-difluoroquinoline (CAS 874831-46-6) is a chemical compound with the molecular formula C9H4ClF2N and a molecular weight of 199.58 g/mol. IUPAC name: 4-chloro-5,7-difluoroquinoline. InChIKey: ZJTFMBZVSQOTPA-UHFFFAOYSA-N.
| Molecular formula | C9H4ClF2N |
|---|---|
| Molecular weight | 199.58 g/mol |
| IUPAC name | 4-chloro-5,7-difluoroquinoline |
| InChIKey | ZJTFMBZVSQOTPA-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C(C=C(C2=C1Cl)F)F |
Computed by PubChem (NCBI)