CAS 1242339-12-3 is the registry number for 3-Chloro-5-(chlorosulfonyl)-2-fluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-chloro-5-chlorosulfonyl-2-fluorobenzoic acid (CAS 1242339-12-3) is a chemical compound with the molecular formula C7H3Cl2FO4S and a molecular weight of 273.06 g/mol. IUPAC name: 3-chloro-5-chlorosulfonyl-2-fluorobenzoic acid. InChIKey: HMQWQWDIXSLBGM-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO4S |
|---|---|
| Molecular weight | 273.06 g/mol |
| IUPAC name | 3-chloro-5-chlorosulfonyl-2-fluorobenzoic acid |
| InChIKey | HMQWQWDIXSLBGM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)