CAS 33866-08-9 is the registry number for 2,4-Dichloro-5-(fluorosulfonyl)benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2,4-dichloro-5-fluorosulfonylbenzoic acid (CAS 33866-08-9) is a chemical compound with the molecular formula C7H3Cl2FO4S and a molecular weight of 273.06 g/mol. IUPAC name: 2,4-dichloro-5-fluorosulfonylbenzoic acid. InChIKey: FANYQDYQQRFEDR-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO4S |
|---|---|
| Molecular weight | 273.06 g/mol |
| IUPAC name | 2,4-dichloro-5-fluorosulfonylbenzoic acid |
| InChIKey | FANYQDYQQRFEDR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)F)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)