CAS 197861-27-1 is the registry number for 4-Chloro-5h-indeno(1,2-d)pyrimidine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-chloro-5H-indeno[1,2-d]pyrimidine (CAS 197861-27-1) is a chemical compound with the molecular formula C11H7ClN2 and a molecular weight of 202.64 g/mol. IUPAC name: 4-chloro-5H-indeno[1,2-d]pyrimidine. InChIKey: ULKSKAHSOWPUCE-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 4-chloro-5H-indeno[1,2-d]pyrimidine |
| InChIKey | ULKSKAHSOWPUCE-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=C1C(=NC=N3)Cl |
Computed by PubChem (NCBI)