Products 158692-52-5
CAS 158692-52-5 appears in our catalog under these names: 2–Chloro–5–Phenyl–1H–Pyrrole–3–Carbonitrile, 2-Chloro-5-phenyl-1h-pyrrole-3-carbonitrile, 95%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g.
2-chloro-5-phenyl-1H-pyrrole-3-carbonitrile (CAS 158692-52-5) is a chemical compound with the molecular formula C11H7ClN2 and a molecular weight of 202.64 g/mol. IUPAC name: 2-chloro-5-phenyl-1H-pyrrole-3-carbonitrile. InChIKey: MMEMWGQBJAUGHN-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 2-chloro-5-phenyl-1H-pyrrole-3-carbonitrile |
| InChIKey | MMEMWGQBJAUGHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(N2)Cl)C#N |
Computed by PubChem (NCBI)