CAS 26869-12-5 appears in our catalog under these names: 2-Chloro-9h-pyrido[2,3-b]indole, 95%, 2-Chloro-9H-pyrido(2,3-b)indole, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 50mg.
2-chloro-9H-pyrido[2,3-b]indole (CAS 26869-12-5) is a chemical compound with the molecular formula C11H7ClN2 and a molecular weight of 202.64 g/mol. IUPAC name: 2-chloro-9H-pyrido[2,3-b]indole. InChIKey: KKTJYGKCUULHIN-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 2-chloro-9H-pyrido[2,3-b]indole |
| InChIKey | KKTJYGKCUULHIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)N=C(C=C3)Cl |
Computed by PubChem (NCBI)