CAS 74896-09-6 is the registry number for 8-Chloro-9H-pyrido[2,3-b]indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-9H-pyrido[2,3-b]indole (CAS 74896-09-6) is a chemical compound with the molecular formula C11H7ClN2 and a molecular weight of 202.64 g/mol. IUPAC name: 8-chloro-9H-pyrido[2,3-b]indole. InChIKey: UZSSXTAROUXYRN-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 8-chloro-9H-pyrido[2,3-b]indole |
| InChIKey | UZSSXTAROUXYRN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC3=C2C=CC=N3 |
Computed by PubChem (NCBI)