4-Chloro-N-(2,2,2-trifluoroethyl)aniline, 97%
cas: 22753-82-8 — see every product listed under this CAS number, including other names
4-Chloro-N-(2,2,2-trifluoroethyl)aniline, 97% (CAS 22753-82-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 250mg, 500mg, 1g, 2.5g, 5g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A545999-100mg |
| cas | 22753-82-8 |
| size | 100mg |
| availability | Synthetic Items: 0g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 447.58 Pln | |
| AmBeed | 10g | 7836.43 Pln | |
| AmBeed | 250mg | 642.88 Pln | |
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 500mg | 643.54 Pln | |
| Fluorochem | 1g | 804.94 Pln | |
| Fluorochem | 2.5g | 1664.02 Pln | |
| Fluorochem | 5g | 3179.11 Pln | |
| Fluorochem | 10g | 5043.03 Pln | |
| Fluorochem | 25g | 11993.71 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-chloro-N-(2,2,2-trifluoroethyl)aniline (CAS 22753-82-8) is a chemical compound with the molecular formula C8H7ClF3N and a molecular weight of 209.59 g/mol. IUPAC name: 4-chloro-N-(2,2,2-trifluoroethyl)aniline. InChIKey: IPGVRHNLRNFLOP-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3N |
|---|---|
| Molecular weight | 209.59 g/mol |
| IUPAC name | 4-chloro-N-(2,2,2-trifluoroethyl)aniline |
| InChIKey | IPGVRHNLRNFLOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NCC(F)(F)F)Cl |
Computed by PubChem (NCBI)