cas: 349-89-3 — see every product listed under this CAS number, including other names
4-Chloro-benzenesulfonyl fluoride 95% (CAS 349-89-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1072605-250mg |
| cas | 349-89-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 414.88 Pln | |
| Ambeed | 25g | 1104.63 Pln | |
| Ambeed | 100g | 2662.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1072605 |
4-chlorobenzenesulfonyl fluoride (CAS 349-89-3) is a chemical compound with the molecular formula C6H4ClFO2S and a molecular weight of 194.61 g/mol. IUPAC name: 4-chlorobenzenesulfonyl fluoride. InChIKey: PCTLRVPDZBVCMP-UHFFFAOYSA-N.
| Molecular formula | C6H4ClFO2S |
|---|---|
| Molecular weight | 194.61 g/mol |
| IUPAC name | 4-chlorobenzenesulfonyl fluoride |
| InChIKey | PCTLRVPDZBVCMP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)F)Cl |
Computed by PubChem (NCBI)