CAS 864872-77-5 appears in our catalog under these names: 2-Chlorobenzenesulfonyl fluoride, 95%, 2-chlorobenzene-1-sulfonyl fluoride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 10g.
2-chlorobenzenesulfonyl fluoride (CAS 864872-77-5) is a chemical compound with the molecular formula C6H4ClFO2S and a molecular weight of 194.61 g/mol. IUPAC name: 2-chlorobenzenesulfonyl fluoride. InChIKey: UOECQWWSUHZUMI-UHFFFAOYSA-N.
| Molecular formula | C6H4ClFO2S |
|---|---|
| Molecular weight | 194.61 g/mol |
| IUPAC name | 2-chlorobenzenesulfonyl fluoride |
| InChIKey | UOECQWWSUHZUMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)S(=O)(=O)F)Cl |
Computed by PubChem (NCBI)