CAS 349-88-2 appears in our catalog under these names: 4-Fluorobenzenesulfonyl Chloride, 4–Fluorobenzenesulfonyl Chloride, 4-Fluorobenzenesulfonyl chloride, 98% , 4-Fluorobenzenesulfonyl chloride, 98%, 4-Fluorobenzenesulfonyl Chloride, >97.0%(GC)(T). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros). Available pack sizes: 1kg, 250g, 50g, 100g, 500g, 25g, 2kg, 5g.
4-fluorobenzenesulfonyl chloride (CAS 349-88-2) is a chemical compound with the molecular formula C6H4ClFO2S and a molecular weight of 194.61 g/mol. IUPAC name: 4-fluorobenzenesulfonyl chloride. InChIKey: BFXHJFKKRGVUMU-UHFFFAOYSA-N.
| Molecular formula | C6H4ClFO2S |
|---|---|
| Molecular weight | 194.61 g/mol |
| IUPAC name | 4-fluorobenzenesulfonyl chloride |
| InChIKey | BFXHJFKKRGVUMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)