Products 349-89-3
CAS 349-89-3 appears in our catalog under these names: 4-Chlorobenzenesulfonyl fluoride, 95%, 4-Chlorobenzenesulfonyl fluoride, 4-Chloro-benzenesulfonyl fluoride 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100g.
4-chlorobenzenesulfonyl fluoride (CAS 349-89-3) is a chemical compound with the molecular formula C6H4ClFO2S and a molecular weight of 194.61 g/mol. IUPAC name: 4-chlorobenzenesulfonyl fluoride. InChIKey: PCTLRVPDZBVCMP-UHFFFAOYSA-N.
| Molecular formula | C6H4ClFO2S |
|---|---|
| Molecular weight | 194.61 g/mol |
| IUPAC name | 4-chlorobenzenesulfonyl fluoride |
| InChIKey | PCTLRVPDZBVCMP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)F)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Chlorobenzenesulfonyl fluoride, p-Chlorobenzenesulfonyl fluoride, 4-Chlorophenylsulfonyl fluoride, Benzenesulfonyl fluoride, p-chloro-, 4-chloro-benzenesulfonyl fluoride, 4-chlorobenzene-1-sulfonyl fluoride, Benzenesulfonyl fluoride, 4-chloro-, Benzenesulfonyl fluoride, 4-chloro- (9CI), 4-chloro-benzenesulfonylfluoride, 4-Chloro-1-benzenesulfonyl Fluoride