cas: 5152-84-1 — see every product listed under this CAS number, including other names
4-Chlorocinnoline, 97%, 97% (CAS 5152-84-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DA91-250mg |
| cas | 5152-84-1 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 2464.40 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 10g | 4859.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-chlorocinnoline (CAS 5152-84-1) is a chemical compound with the molecular formula C8H5ClN2 and a molecular weight of 164.59 g/mol. IUPAC name: 4-chlorocinnoline. InChIKey: IJSFFUOWXQRDMS-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2 |
|---|---|
| Molecular weight | 164.59 g/mol |
| IUPAC name | 4-chlorocinnoline |
| InChIKey | IJSFFUOWXQRDMS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=N2)Cl |
Computed by PubChem (NCBI)