cas: 51674-77-2 — see every product listed under this CAS number, including other names
4-Chloropyrido[3,2-d]pyrimidine 95% (CAS 51674-77-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A132138-250mg |
| cas | 51674-77-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 759.75 Pln | |
| Ambeed | 5g | 1922.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A132138 |
4-chloropyrido[3,2-d]pyrimidine (CAS 51674-77-2) is a chemical compound with the molecular formula C7H4ClN3 and a molecular weight of 165.58 g/mol. IUPAC name: 4-chloropyrido[3,2-d]pyrimidine. InChIKey: PVTHTRIHQGKZNE-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3 |
|---|---|
| Molecular weight | 165.58 g/mol |
| IUPAC name | 4-chloropyrido[3,2-d]pyrimidine |
| InChIKey | PVTHTRIHQGKZNE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC=N2)Cl)N=C1 |
Computed by PubChem (NCBI)