CAS 153775-42-9 appears in our catalog under these names: 4-Cyano-3-nitrobenzoic acid, 98%, 98%, 4-Cyano-3-nitrobenzoic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 500g, 100g.
4-cyano-3-nitrobenzoic acid (CAS 153775-42-9) is a chemical compound with the molecular formula C8H4N2O4 and a molecular weight of 192.13 g/mol. IUPAC name: 4-cyano-3-nitrobenzoic acid. InChIKey: JVPRJKPSKHSUDO-UHFFFAOYSA-N.
| Molecular formula | C8H4N2O4 |
|---|---|
| Molecular weight | 192.13 g/mol |
| IUPAC name | 4-cyano-3-nitrobenzoic acid |
| InChIKey | JVPRJKPSKHSUDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)