CAS 20029-52-1 appears in our catalog under these names: 4-Cyclohexylbenzoic acid, 95%, 4–Cyclohexylbenzoic Acid, 4-Cyclohexylbenzoic acid/ 98%, 4-Cyclohexylbenzoic acid, 98% , 4-Cyclohexylbenzoic Acid, >98.0%(GC)(T). Offered by: Combi-blocks, GLPBio, Chemat, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 25g, 5g, 2g, 10g, 50g, 25mg.
4-cyclohexylbenzoic acid (CAS 20029-52-1) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 4-cyclohexylbenzoic acid. InChIKey: QCIWHVKGVVQHIY-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 4-cyclohexylbenzoic acid |
| InChIKey | QCIWHVKGVVQHIY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)