4-Cyclopropoxybenzoic acid, 95%
cas: 62577-90-6 — see every product listed under this CAS number, including other names
4-Cyclopropoxybenzoic acid, 95% (CAS 62577-90-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A218578-100mg |
| cas | 62577-90-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 871.00 Pln | |
| Ambeed | 1g | 2206.00 Pln | |
| Ambeed | 5g | 7851.94 Pln | |
| Ambeed | 10g | 15439.19 Pln | |
| BLDpharm | 100mg | 530.95 Pln | |
| BLDpharm | 250mg | 853.06 Pln | |
| BLDpharm | 1g | 2163.71 Pln | |
| BLDpharm | 5g | 8361.52 Pln | |
| BLDpharm | 10g | 16641.94 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-cyclopropyloxybenzoic acid (CAS 62577-90-6) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 4-cyclopropyloxybenzoic acid. InChIKey: VUANULXCHKBPDD-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 4-cyclopropyloxybenzoic acid |
| InChIKey | VUANULXCHKBPDD-UHFFFAOYSA-N |
| SMILES | C1CC1OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)