cas: 62577-90-6 — see every product listed under this CAS number, including other names
4-Cyclopropoxybenzoic acid, 95% (CAS 62577-90-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F775087-100MG |
| cas | 62577-90-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 612.30 Pln | |
| Fluorochem | 250mg | 981.96 Pln | |
| Fluorochem | 1g | 2538.71 Pln | |
| Fluorochem | 5g | 11155.46 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-cyclopropyloxybenzoic acid (CAS 62577-90-6) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 4-cyclopropyloxybenzoic acid. InChIKey: VUANULXCHKBPDD-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 4-cyclopropyloxybenzoic acid |
| InChIKey | VUANULXCHKBPDD-UHFFFAOYSA-N |
| SMILES | C1CC1OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)