cas: 2713-74-8 — see every product listed under this CAS number, including other names
4-Ethoxy-3-trifluoromethyl-phenylamine (CAS 2713-74-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F060099-1G |
| cas | 2713-74-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 596.68 Pln | |
| Fluorochem | 25g | 2262.76 Pln | |
| Fluorochem | 100g | 6058.30 Pln |
| delivery time | 3-4 weeks |
|---|
4-ethoxy-3-(trifluoromethyl)aniline (CAS 2713-74-8) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: 4-ethoxy-3-(trifluoromethyl)aniline. InChIKey: YAIGBJRRAPBODW-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 4-ethoxy-3-(trifluoromethyl)aniline |
| InChIKey | YAIGBJRRAPBODW-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)