4-Ethyl-4'-ethynyl-1,1'-biphenyl, 97%
cas: 477587-89-6 — see every product listed under this CAS number, including other names
4-Ethyl-4'-ethynyl-1,1'-biphenyl, 97% (CAS 477587-89-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g, 25g, 100g, 250mg. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QV-2776-5g |
| cas | 477587-89-6 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 195.78 Pln | |
| Fluorochem | 25g | 367.60 Pln | |
| Fluorochem | 100g | 1039.24 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 153.44 Pln | |
| Ambeed | 25g | 442.69 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 100g | 722.00 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 158.86 Pln | |
| BLDpharm | 25g | 469.86 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1-ethyl-4-(4-ethynylphenyl)benzene (CAS 477587-89-6) is a chemical compound with the molecular formula C16H14 and a molecular weight of 206.28 g/mol. IUPAC name: 1-ethyl-4-(4-ethynylphenyl)benzene. InChIKey: LMCBMOAZJXJAIV-UHFFFAOYSA-N.
| Molecular formula | C16H14 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 1-ethyl-4-(4-ethynylphenyl)benzene |
| InChIKey | LMCBMOAZJXJAIV-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CC=C(C=C2)C#C |
Computed by PubChem (NCBI)