cas: 141872-92-6 — see every product listed under this CAS number, including other names
4-Fluoro-1-methyl-2-(trifluoromethyl)benzene, 98% (CAS 141872-92-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F327600-1G |
| cas | 141872-92-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 10g | 778.91 Pln | |
| Fluorochem | 25g | 1283.94 Pln | |
| Fluorochem | 50g | 2512.67 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-fluoro-1-methyl-2-(trifluoromethyl)benzene (CAS 141872-92-6) is a chemical compound with the molecular formula C8H6F4 and a molecular weight of 178.13 g/mol. IUPAC name: 4-fluoro-1-methyl-2-(trifluoromethyl)benzene. InChIKey: XXLNKGOPDHIOCS-UHFFFAOYSA-N.
| Molecular formula | C8H6F4 |
|---|---|
| Molecular weight | 178.13 g/mol |
| IUPAC name | 4-fluoro-1-methyl-2-(trifluoromethyl)benzene |
| InChIKey | XXLNKGOPDHIOCS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)F)C(F)(F)F |
Computed by PubChem (NCBI)