4-Fluoro-1H-indazole-3-carboxylic acid, 97%
cas: 885521-64-2 — see every product listed under this CAS number, including other names
4-Fluoro-1H-indazole-3-carboxylic acid, 97% (CAS 885521-64-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A264350-250mg |
| cas | 885521-64-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 909.94 Pln | |
| Ambeed | 1g | 2317.25 Pln | |
| Ambeed | 5g | 5549.06 Pln | |
| BLDpharm | 100mg | 553.16 Pln | |
| BLDpharm | 250mg | 975.24 Pln | |
| BLDpharm | 1g | 2496.92 Pln | |
| BLDpharm | 5g | 5973.48 Pln | |
| Fluorochem | 100mg | 742.46 Pln | |
| Fluorochem | 250mg | 981.96 Pln | |
| Fluorochem | 500mg | 1851.45 Pln | |
| Fluorochem | 1g | 2543.91 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-fluoro-1H-indazole-3-carboxylic acid (CAS 885521-64-2) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 4-fluoro-1H-indazole-3-carboxylic acid. InChIKey: PVBIDQDQVMTZMT-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 4-fluoro-1H-indazole-3-carboxylic acid |
| InChIKey | PVBIDQDQVMTZMT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)