CAS 129295-30-3 appears in our catalog under these names: 6–Fluoro–1H–indazole–3–carboxylic acid, 6-Fluoro-1H-indazole-3-carboxylic acid, 96%, 6-Fluoro-1H-indazole-3-carboxylic acid 98%, 6-FLUORO-1H-INDAZOLE-3-CARBOXYLIC ACID, 97%, 6-Fluoro-1H-indazole-3-carboxylic acid, 97%, 97%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 10g, 5g, 100mg, 500mg, 2.5g.
6-fluoro-1H-indazole-3-carboxylic acid (CAS 129295-30-3) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 6-fluoro-1H-indazole-3-carboxylic acid. InChIKey: KNPFUABTEGLQBG-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 6-fluoro-1H-indazole-3-carboxylic acid |
| InChIKey | KNPFUABTEGLQBG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)NN=C2C(=O)O |
Computed by PubChem (NCBI)