CAS 143884-84-8 appears in our catalog under these names: 7-Fluoro-3-(hydroxyimino)indolin-2-one, 96%, 7-Fluoroisatin-3-oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g, 100g.
7-fluoro-3-nitroso-1H-indol-2-ol (CAS 143884-84-8) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 7-fluoro-3-nitroso-1H-indol-2-ol. InChIKey: OCGNSRRMJCCGCE-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 7-fluoro-3-nitroso-1H-indol-2-ol |
| InChIKey | OCGNSRRMJCCGCE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)NC(=C2N=O)O |
Computed by PubChem (NCBI)