Products 1044766-09-7
CAS 1044766-09-7 appears in our catalog under these names: 5-(2-Fluorophenyl)-1,3,4-oxadiazol-2(3h)-one, 98%, 5-(2-Fluorophenyl)-1,3,4-oxadiazol-2(3H)-one, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100mg.
5-(2-fluorophenyl)-3H-1,3,4-oxadiazol-2-one (CAS 1044766-09-7) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 5-(2-fluorophenyl)-3H-1,3,4-oxadiazol-2-one. InChIKey: GRLMQTZJXSLUBV-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-3H-1,3,4-oxadiazol-2-one |
| InChIKey | GRLMQTZJXSLUBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=O)O2)F |
Computed by PubChem (NCBI)