4-Fluoro-2-methoxybenzene-1-sulfonyl chloride, 98%
cas: 1214377-19-1 — see every product listed under this CAS number, including other names
4-Fluoro-2-methoxybenzene-1-sulfonyl chloride, 98% (CAS 1214377-19-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F718526-100MG |
| cas | 1214377-19-1 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 586.27 Pln | |
| Fluorochem | 250mg | 883.04 Pln | |
| Fluorochem | 1g | 2330.45 Pln | |
| Fluorochem | 5g | 6709.11 Pln | |
| Ambeed | 250mg | 865.44 Pln | |
| Ambeed | 1g | 2283.88 Pln | |
| Ambeed | 5g | 6683.81 Pln | |
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 630.80 Pln | |
| Chemat | 1g | 1538.00 Pln | |
| Chemat | 5g | 6270.80 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-fluoro-2-methoxybenzenesulfonyl chloride (CAS 1214377-19-1) is a chemical compound with the molecular formula C7H6ClFO3S and a molecular weight of 224.64 g/mol. IUPAC name: 4-fluoro-2-methoxybenzenesulfonyl chloride. InChIKey: IDGYBLMLBADGPP-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO3S |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 4-fluoro-2-methoxybenzenesulfonyl chloride |
| InChIKey | IDGYBLMLBADGPP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)