cas: 67515-60-0 — see every product listed under this CAS number, including other names
4-Fluoro-3-(trifluoromethyl)benzaldehyde, 97%, 97% (CAS 67515-60-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1171C8-1g |
| cas | 67515-60-0 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 179.60 Pln | |
| Chemat | 100g | 525.20 Pln | |
| Chemat | 500g | 2457.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-fluoro-3-(trifluoromethyl)benzaldehyde (CAS 67515-60-0) is a chemical compound with the molecular formula C8H4F4O and a molecular weight of 192.11 g/mol. IUPAC name: 4-fluoro-3-(trifluoromethyl)benzaldehyde. InChIKey: BIUDHHGROGJSHN-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O |
|---|---|
| Molecular weight | 192.11 g/mol |
| IUPAC name | 4-fluoro-3-(trifluoromethyl)benzaldehyde |
| InChIKey | BIUDHHGROGJSHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)C(F)(F)F)F |
Computed by PubChem (NCBI)